C12ClF21 — CID 12600359
1-(2-chloro-1,1,1,3,3,3-hexafluoropropan-2-yl)-3,3-difluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,4-bis(trifluoromethyl)cyclobutene (PubChem CID 12600359) has the molecular formula C12ClF21 and a molecular weight of 578.54 g/mol. Its IUPAC name is 1-(2-chloro-1,1,1,3,3,3-hexafluoropropan-2-yl)-3,3-difluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,4-bis(trifluoromethyl)cyclobutene.
| Compound Name | 1-(2-chloro-1,1,1,3,3,3-hexafluoropropan-2-yl)-3,3-difluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,4-bis(trifluoromethyl)cyclobutene |
|---|---|
| PubChem CID | 12600359 |
| Molecular Formula | C12ClF21 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 577.94 |
| IUPAC Name | 1-(2-chloro-1,1,1,3,3,3-hexafluoropropan-2-yl)-3,3-difluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,4-bis(trifluoromethyl)cyclobutene |
| SMILES | FC(F)(F)C(F)(C1=C(C(Cl)(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C12ClF21/c13-4(9(23,24)25,10(26,27)28)1-2(5(14,11(29,30)31)12(32,33)34)6(15,16)3(1,7(17,18)19)8(20,21)22 |
| InChIKey | WITAXELTLLEYDP-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|