C11F20 — CID 155681385
1,3,3,4,4-pentafluoro-2-[1,1,1,3,3,4,5,5,5-nonafluoro-2,4-bis(trifluoromethyl)pentan-2-yl]cyclobutene (PubChem CID 155681385) has the molecular formula C11F20 and a molecular weight of 512.08 g/mol. Its IUPAC name is 1,3,3,4,4-pentafluoro-2-[1,1,1,3,3,4,5,5,5-nonafluoro-2,4-bis(trifluoromethyl)pentan-2-yl]cyclobutene.
| Compound Name | 1,3,3,4,4-pentafluoro-2-[1,1,1,3,3,4,5,5,5-nonafluoro-2,4-bis(trifluoromethyl)pentan-2-yl]cyclobutene |
|---|---|
| PubChem CID | 155681385 |
| Molecular Formula | C11F20 |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.97 |
| IUPAC Name | 1,3,3,4,4-pentafluoro-2-[1,1,1,3,3,4,5,5,5-nonafluoro-2,4-bis(trifluoromethyl)pentan-2-yl]cyclobutene |
| SMILES | FC1=C(C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11F20/c12-2-1(4(13,14)5(2,15)16)3(8(20,21)22,9(23,24)25)7(18,19)6(17,10(26,27)28)11(29,30)31 |
| InChIKey | CETIJKMPEKQAFB-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|