C14F22 — CID 12563814
1,3,3,4,4,5,5,6,6-nonafluoro-2-[2,2,3,3,4,4-hexafluoro-1-(1,2,2,3,3,4,4-heptafluorocyclobutyl)cyclobutyl]cyclohexene (PubChem CID 12563814) has the molecular formula C14F22 and a molecular weight of 586.11 g/mol. Its IUPAC name is 1,3,3,4,4,5,5,6,6-nonafluoro-2-[2,2,3,3,4,4-hexafluoro-1-(1,2,2,3,3,4,4-heptafluorocyclobutyl)cyclobutyl]cyclohexene.
| Compound Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-[2,2,3,3,4,4-hexafluoro-1-(1,2,2,3,3,4,4-heptafluorocyclobutyl)cyclobutyl]cyclohexene |
|---|---|
| PubChem CID | 12563814 |
| Molecular Formula | C14F22 |
| Molecular Weight | 586.11 g/mol |
| Exact Mass | 585.96 |
| IUPAC Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-[2,2,3,3,4,4-hexafluoro-1-(1,2,2,3,3,4,4-heptafluorocyclobutyl)cyclobutyl]cyclohexene |
| SMILES | FC1=C(C2(C3(F)C(F)(F)C(F)(F)C3(F)F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14F22/c15-2-1(4(16,17)9(25,26)10(27,28)5(2,18)19)3(7(21,22)13(33,34)8(3,23)24)6(20)11(29,30)14(35,36)12(6,31)32 |
| InChIKey | WKQADFLEGWWOQQ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.11 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|