C16F24 — CID 134977949
1,2,3,4,5,6,7,8-octakis(trifluoromethyl)tricyclo[4.2.0.02,5]octa-3,7-diene (PubChem CID 134977949) has the molecular formula C16F24 and a molecular weight of 648.13 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octakis(trifluoromethyl)tricyclo[4.2.0.02,5]octa-3,7-diene.
| Compound Name | 1,2,3,4,5,6,7,8-octakis(trifluoromethyl)tricyclo[4.2.0.02,5]octa-3,7-diene |
|---|---|
| PubChem CID | 134977949 |
| Molecular Formula | C16F24 |
| Molecular Weight | 648.13 g/mol |
| Exact Mass | 647.96 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octakis(trifluoromethyl)tricyclo[4.2.0.02,5]octa-3,7-diene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C2(C(F)(F)F)C1(C(F)(F)F)C1(C(F)(F)F)C(C(F)(F)F)=C(C(F)(F)F)C21C(F)(F)F |
| InChI | InChI=1S/C16F24/c17-9(18,19)1-2(10(20,21)22)6(14(32,33)34)5(1,13(29,30)31)7(15(35,36)37)3(11(23,24)25)4(12(26,27)28)8(6,7)16(38,39)40 |
| InChIKey | MAOSMLXIRYXVPB-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.13 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|