C11F18 — CID 12563820
1,1,2,2,3,3,4-heptafluoro-4-[1,1,1,3,3,3-hexafluoro-2-(2,3,3,4,4-pentafluorocyclobuten-1-yl)propan-2-yl]cyclobutane (PubChem CID 12563820) has the molecular formula C11F18 and a molecular weight of 474.09 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptafluoro-4-[1,1,1,3,3,3-hexafluoro-2-(2,3,3,4,4-pentafluorocyclobuten-1-yl)propan-2-yl]cyclobutane.
| Compound Name | 1,1,2,2,3,3,4-heptafluoro-4-[1,1,1,3,3,3-hexafluoro-2-(2,3,3,4,4-pentafluorocyclobuten-1-yl)propan-2-yl]cyclobutane |
|---|---|
| PubChem CID | 12563820 |
| Molecular Formula | C11F18 |
| Molecular Weight | 474.09 g/mol |
| Exact Mass | 473.97 |
| IUPAC Name | 1,1,2,2,3,3,4-heptafluoro-4-[1,1,1,3,3,3-hexafluoro-2-(2,3,3,4,4-pentafluorocyclobuten-1-yl)propan-2-yl]cyclobutane |
| SMILES | FC1=C(C(C(F)(F)F)(C(F)(F)F)C2(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11F18/c12-2-1(4(13,14)5(2,15)16)3(10(24,25)26,11(27,28)29)6(17)7(18,19)9(22,23)8(6,20)21 |
| InChIKey | OFYOFRCBBNISLM-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.09 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|