C12F22 — CID 550630
1-[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(trifluoromethyl)pentan-3-yl]-2,3,3,4,4,5,5,6,6-nonafluorocyclohexene (PubChem CID 550630) has the molecular formula C12F22 and a molecular weight of 562.09 g/mol. Its IUPAC name is 1-[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(trifluoromethyl)pentan-3-yl]-2,3,3,4,4,5,5,6,6-nonafluorocyclohexene.
| Compound Name | 1-[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(trifluoromethyl)pentan-3-yl]-2,3,3,4,4,5,5,6,6-nonafluorocyclohexene |
|---|---|
| PubChem CID | 550630 |
| Molecular Formula | C12F22 |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.96 |
| IUPAC Name | 1-[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(trifluoromethyl)pentan-3-yl]-2,3,3,4,4,5,5,6,6-nonafluorocyclohexene |
| SMILES | FC1=C(C(C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12F22/c13-2-1(4(14,15)8(22,23)9(24,25)5(2,16)17)3(10(26,27)28,6(18,19)11(29,30)31)7(20,21)12(32,33)34 |
| InChIKey | WOZIUQUOEDVWOH-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|