C11F18 — CID 576671
1,1,2,2,3,4,4,5,5,6,6,7,7-tridecafluoro-3-(1,1,2,2,2-pentafluoroethyl)indene (PubChem CID 576671) has the molecular formula C11F18 and a molecular weight of 474.09 g/mol. Its IUPAC name is 1,1,2,2,3,4,4,5,5,6,6,7,7-tridecafluoro-3-(1,1,2,2,2-pentafluoroethyl)indene.
| Compound Name | 1,1,2,2,3,4,4,5,5,6,6,7,7-tridecafluoro-3-(1,1,2,2,2-pentafluoroethyl)indene |
|---|---|
| PubChem CID | 576671 |
| Molecular Formula | C11F18 |
| Molecular Weight | 474.09 g/mol |
| Exact Mass | 473.97 |
| IUPAC Name | 1,1,2,2,3,4,4,5,5,6,6,7,7-tridecafluoro-3-(1,1,2,2,2-pentafluoroethyl)indene |
| SMILES | FC(F)(F)C(F)(F)C1(F)C2=C(C(F)(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11F18/c12-3(8(21,22)11(27,28)29)1-2(5(15,16)7(3,19)20)6(17,18)10(25,26)9(23,24)4(1,13)14 |
| InChIKey | QQUGLYWUHJAQCF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.09 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|