C12HF21 — CID 12600358
4,4-difluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,3-bis(trifluoromethyl)cyclobutene (PubChem CID 12600358) has the molecular formula C12HF21 and a molecular weight of 544.10 g/mol. Its IUPAC name is 4,4-difluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,3-bis(trifluoromethyl)cyclobutene.
| Compound Name | 4,4-difluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,3-bis(trifluoromethyl)cyclobutene |
|---|---|
| PubChem CID | 12600358 |
| Molecular Formula | C12HF21 |
| Molecular Weight | 544.10 g/mol |
| Exact Mass | 543.97 |
| IUPAC Name | 4,4-difluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,3-bis(trifluoromethyl)cyclobutene |
| SMILES | FC(F)(F)C(C1=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C1(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12HF21/c13-5(11(28,29)30,12(31,32)33)2-1(3(7(16,17)18)8(19,20)21)4(6(2,14)15,9(22,23)24)10(25,26)27/h3H |
| InChIKey | SIJSVMFQIOBRTQ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.10 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|