C10H2F16 — CID 134879577
1,4,5,5-tetrafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,3-bis(trifluoromethyl)cyclopentene (PubChem CID 134879577) has the molecular formula C10H2F16 and a molecular weight of 426.09 g/mol. Its IUPAC name is 1,4,5,5-tetrafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,3-bis(trifluoromethyl)cyclopentene.
| Compound Name | 1,4,5,5-tetrafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,3-bis(trifluoromethyl)cyclopentene |
|---|---|
| PubChem CID | 134879577 |
| Molecular Formula | C10H2F16 |
| Molecular Weight | 426.09 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 1,4,5,5-tetrafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,3-bis(trifluoromethyl)cyclopentene |
| SMILES | FC1=C(C(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C(F)C1(F)F |
| InChI | InChI=1S/C10H2F16/c11-3-1(2(7(15,16)17)8(18,19)20)5(9(21,22)23,10(24,25)26)4(12)6(3,13)14/h2,4H |
| InChIKey | GPRNYRUOZDRHOI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.09 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |