C19F36 — CID 155681379
3,3,4,4,5,5-hexafluoro-1,2-bis[1,1,1,3,3,4,5,5,5-nonafluoro-2,4-bis(trifluoromethyl)pentan-2-yl]cyclopentene (PubChem CID 155681379) has the molecular formula C19F36 and a molecular weight of 912.14 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1,2-bis[1,1,1,3,3,4,5,5,5-nonafluoro-2,4-bis(trifluoromethyl)pentan-2-yl]cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1,2-bis[1,1,1,3,3,4,5,5,5-nonafluoro-2,4-bis(trifluoromethyl)pentan-2-yl]cyclopentene |
|---|---|
| PubChem CID | 155681379 |
| Molecular Formula | C19F36 |
| Molecular Weight | 912.14 g/mol |
| Exact Mass | 911.94 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1,2-bis[1,1,1,3,3,4,5,5,5-nonafluoro-2,4-bis(trifluoromethyl)pentan-2-yl]cyclopentene |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(C1=C(C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19F36/c20-5(21)1(3(12(32,33)34,13(35,36)37)9(26,27)7(24,16(44,45)46)17(47,48)49)2(6(22,23)11(5,30)31)4(14(38,39)40,15(41,42)43)10(28,29)8(25,18(50,51)52)19(53,54)55 |
| InChIKey | QNYPSXMHRHKGAB-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.14 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|