C10H2F16 — CID 54369101
2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3,3-tris(trifluoromethyl)cyclobutene (PubChem CID 54369101) has the molecular formula C10H2F16 and a molecular weight of 426.09 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3,3-tris(trifluoromethyl)cyclobutene.
| Compound Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3,3-tris(trifluoromethyl)cyclobutene |
|---|---|
| PubChem CID | 54369101 |
| Molecular Formula | C10H2F16 |
| Molecular Weight | 426.09 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3,3-tris(trifluoromethyl)cyclobutene |
| SMILES | FC(F)(F)C1=C(C(F)(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H2F16/c11-5(9(21,22)23,10(24,25)26)3-2(6(12,13)14)1-4(3,7(15,16)17)8(18,19)20/h1H2 |
| InChIKey | URWMOMJLJAMJRP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.09 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|