C12H2F20 — CID 13108420
3,3-difluoro-1,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)-4,4-bis(trifluoromethyl)cyclobutene (PubChem CID 13108420) has the molecular formula C12H2F20 and a molecular weight of 526.11 g/mol. Its IUPAC name is 3,3-difluoro-1,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)-4,4-bis(trifluoromethyl)cyclobutene.
| Compound Name | 3,3-difluoro-1,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)-4,4-bis(trifluoromethyl)cyclobutene |
|---|---|
| PubChem CID | 13108420 |
| Molecular Formula | C12H2F20 |
| Molecular Weight | 526.11 g/mol |
| Exact Mass | 525.98 |
| IUPAC Name | 3,3-difluoro-1,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)-4,4-bis(trifluoromethyl)cyclobutene |
| SMILES | FC(F)(F)C(C1=C(C(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H2F20/c13-6(14)2(4(9(21,22)23)10(24,25)26)1(3(7(15,16)17)8(18,19)20)5(6,11(27,28)29)12(30,31)32/h3-4H |
| InChIKey | VHMYIEOQWVZRGJ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.11 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|