C14H2F24 — CID 57185538
1,2-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3,4-bis(trifluoromethyl)cyclobutene (PubChem CID 57185538) has the molecular formula C14H2F24 and a molecular weight of 626.12 g/mol. Its IUPAC name is 1,2-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3,4-bis(trifluoromethyl)cyclobutene.
| Compound Name | 1,2-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3,4-bis(trifluoromethyl)cyclobutene |
|---|---|
| PubChem CID | 57185538 |
| Molecular Formula | C14H2F24 |
| Molecular Weight | 626.12 g/mol |
| Exact Mass | 625.98 |
| IUPAC Name | 1,2-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3,4-bis(trifluoromethyl)cyclobutene |
| SMILES | FC(F)(F)C1C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1C(F)(F)F |
| InChI | InChI=1S/C14H2F24/c15-5(16,9(25,26)11(29,30)13(33,34)35)1-2(4(8(22,23)24)3(1)7(19,20)21)6(17,18)10(27,28)12(31,32)14(36,37)38/h3-4H |
| InChIKey | WNUPRRCHXJQMRF-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.12 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|