C17H13F17 — CID 15912830
1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2,3,4,5-tetramethylcyclopenta-1,3-diene (PubChem CID 15912830) has the molecular formula C17H13F17 and a molecular weight of 540.26 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2,3,4,5-tetramethylcyclopenta-1,3-diene.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2,3,4,5-tetramethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 15912830 |
| Molecular Formula | C17H13F17 |
| Molecular Weight | 540.26 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2,3,4,5-tetramethylcyclopenta-1,3-diene |
| SMILES | CC1=C(C)C(C)C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=C1C |
| InChI | InChI=1S/C17H13F17/c1-5-6(2)8(4)9(7(5)3)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h7H,1-4H3 |
| InChIKey | PVHNZFPTHKYINK-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.26 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|