C9F16 — CID 12708036
3,3-difluoro-1-(1,1,2,2,2-pentafluoroethyl)-2,4,4-tris(trifluoromethyl)cyclobutene (PubChem CID 12708036) has the molecular formula C9F16 and a molecular weight of 412.07 g/mol. Its IUPAC name is 3,3-difluoro-1-(1,1,2,2,2-pentafluoroethyl)-2,4,4-tris(trifluoromethyl)cyclobutene.
| Compound Name | 3,3-difluoro-1-(1,1,2,2,2-pentafluoroethyl)-2,4,4-tris(trifluoromethyl)cyclobutene |
|---|---|
| PubChem CID | 12708036 |
| Molecular Formula | C9F16 |
| Molecular Weight | 412.07 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | 3,3-difluoro-1-(1,1,2,2,2-pentafluoroethyl)-2,4,4-tris(trifluoromethyl)cyclobutene |
| SMILES | FC(F)(F)C1=C(C(F)(F)C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C9F16/c10-4(11)2(6(14,15)16)1(5(12,13)9(23,24)25)3(4,7(17,18)19)8(20,21)22 |
| InChIKey | IFFSWRSBCZFNSQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.07 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|