C8F14 — CID 14007675
1,3,3,4,4-pentafluoro-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclobutene (PubChem CID 14007675) has the molecular formula C8F14 and a molecular weight of 362.06 g/mol. Its IUPAC name is 1,3,3,4,4-pentafluoro-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclobutene.
| Compound Name | 1,3,3,4,4-pentafluoro-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclobutene |
|---|---|
| PubChem CID | 14007675 |
| Molecular Formula | C8F14 |
| Molecular Weight | 362.06 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 1,3,3,4,4-pentafluoro-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclobutene |
| SMILES | FC1=C(C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8F14/c9-2-1(4(10,11)5(2,12)13)3(6(14,15)16,7(17,18)19)8(20,21)22 |
| InChIKey | SBBHUAWJGBYREY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.06 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|