C10F20 — CID 22642014
(E)-1,1,1,2,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,4-bis(trifluoromethyl)pent-2-ene (PubChem CID 22642014) has the molecular formula C10F20 and a molecular weight of 500.07 g/mol. Its IUPAC name is (E)-1,1,1,2,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,4-bis(trifluoromethyl)pent-2-ene.
| Compound Name | (E)-1,1,1,2,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,4-bis(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 22642014 |
| Molecular Formula | C10F20 |
| Molecular Weight | 500.07 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | (E)-1,1,1,2,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,4-bis(trifluoromethyl)pent-2-ene |
| SMILES | F/C(=C(/C(F)(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10F20/c11-2(5(13,14)15)1(4(12,9(25,26)27)10(28,29)30)3(6(16,17)18,7(19,20)21)8(22,23)24/b2-1+ |
| InChIKey | TVLCPWRXKMDNKI-OWOJBTEDSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.07 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |