C9F18 — CID 12860796
1,1,1,3,4,4,6,6,6-nonafluoro-2,5,5-tris(trifluoromethyl)hex-2-ene (PubChem CID 12860796) has the molecular formula C9F18 and a molecular weight of 450.06 g/mol. Its IUPAC name is 1,1,1,3,4,4,6,6,6-nonafluoro-2,5,5-tris(trifluoromethyl)hex-2-ene.
| Compound Name | 1,1,1,3,4,4,6,6,6-nonafluoro-2,5,5-tris(trifluoromethyl)hex-2-ene |
|---|---|
| PubChem CID | 12860796 |
| Molecular Formula | C9F18 |
| Molecular Weight | 450.06 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | 1,1,1,3,4,4,6,6,6-nonafluoro-2,5,5-tris(trifluoromethyl)hex-2-ene |
| SMILES | FC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9F18/c10-2(1(4(13,14)15)5(16,17)18)3(11,12)6(7(19,20)21,8(22,23)24)9(25,26)27 |
| InChIKey | ORGUEFMMFUNIRG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.06 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |