C10HF19 — CID 5352547
(E)-4-(difluoromethyl)-1,1,1,2,5,5,6,6,6-nonafluoro-4-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)hex-2-ene (PubChem CID 5352547) has the molecular formula C10HF19 and a molecular weight of 482.08 g/mol. Its IUPAC name is (E)-4-(difluoromethyl)-1,1,1,2,5,5,6,6,6-nonafluoro-4-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)hex-2-ene.
| Compound Name | (E)-4-(difluoromethyl)-1,1,1,2,5,5,6,6,6-nonafluoro-4-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)hex-2-ene |
|---|---|
| PubChem CID | 5352547 |
| Molecular Formula | C10HF19 |
| Molecular Weight | 482.08 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | (E)-4-(difluoromethyl)-1,1,1,2,5,5,6,6,6-nonafluoro-4-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)hex-2-ene |
| SMILES | F/C(=C(/C(F)(F)F)C(C(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10HF19/c11-2(6(17,18)19)1(5(14,15)16)4(3(12)13,7(20,21)9(24,25)26)8(22,23)10(27,28)29/h3H/b2-1+ |
| InChIKey | ADJBAYXUHDZVRL-OWOJBTEDSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.08 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|