C12F22 — CID 12710297
(5E)-1,1,1,4,4,5,7,8,8,8-decafluoro-2,3,6,7-tetrakis(trifluoromethyl)octa-2,5-diene (PubChem CID 12710297) has the molecular formula C12F22 and a molecular weight of 562.09 g/mol. Its IUPAC name is (5E)-1,1,1,4,4,5,7,8,8,8-decafluoro-2,3,6,7-tetrakis(trifluoromethyl)octa-2,5-diene.
| Compound Name | (5E)-1,1,1,4,4,5,7,8,8,8-decafluoro-2,3,6,7-tetrakis(trifluoromethyl)octa-2,5-diene |
|---|---|
| PubChem CID | 12710297 |
| Molecular Formula | C12F22 |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.96 |
| IUPAC Name | (5E)-1,1,1,4,4,5,7,8,8,8-decafluoro-2,3,6,7-tetrakis(trifluoromethyl)octa-2,5-diene |
| SMILES | F/C(=C(/C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(=C(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12F22/c13-4(3(10(26,27)28)6(16,11(29,30)31)12(32,33)34)5(14,15)1(7(17,18)19)2(8(20,21)22)9(23,24)25/b4-3+ |
| InChIKey | BFVGFSOTGDXRMU-ONEGZZNKSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|