C14F28 — CID 134874191
4-(difluoromethylidene)-1,1,1,2,2,6,6,7,7,7-decafluoro-3,5-bis(1,1,2,2,2-pentafluoroethyl)-3,5-bis(trifluoromethyl)heptane (PubChem CID 134874191) has the molecular formula C14F28 and a molecular weight of 700.10 g/mol. Its IUPAC name is 4-(difluoromethylidene)-1,1,1,2,2,6,6,7,7,7-decafluoro-3,5-bis(1,1,2,2,2-pentafluoroethyl)-3,5-bis(trifluoromethyl)heptane.
| Compound Name | 4-(difluoromethylidene)-1,1,1,2,2,6,6,7,7,7-decafluoro-3,5-bis(1,1,2,2,2-pentafluoroethyl)-3,5-bis(trifluoromethyl)heptane |
|---|---|
| PubChem CID | 134874191 |
| Molecular Formula | C14F28 |
| Molecular Weight | 700.10 g/mol |
| Exact Mass | 699.96 |
| IUPAC Name | 4-(difluoromethylidene)-1,1,1,2,2,6,6,7,7,7-decafluoro-3,5-bis(1,1,2,2,2-pentafluoroethyl)-3,5-bis(trifluoromethyl)heptane |
| SMILES | FC(F)=C(C(C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)C(C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14F28/c15-2(16)1(3(9(25,26)27,5(17,18)11(31,32)33)6(19,20)12(34,35)36)4(10(28,29)30,7(21,22)13(37,38)39)8(23,24)14(40,41)42 |
| InChIKey | BTAIMSYOPLPRHS-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.10 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|