C8F16 — CID 12708030
4-(difluoromethylidene)-1,1,1,2,2,3,5,5,6,6,6-undecafluoro-3-(trifluoromethyl)hexane (PubChem CID 12708030) has the molecular formula C8F16 and a molecular weight of 400.06 g/mol. Its IUPAC name is 4-(difluoromethylidene)-1,1,1,2,2,3,5,5,6,6,6-undecafluoro-3-(trifluoromethyl)hexane.
| Compound Name | 4-(difluoromethylidene)-1,1,1,2,2,3,5,5,6,6,6-undecafluoro-3-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 12708030 |
| Molecular Formula | C8F16 |
| Molecular Weight | 400.06 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 4-(difluoromethylidene)-1,1,1,2,2,3,5,5,6,6,6-undecafluoro-3-(trifluoromethyl)hexane |
| SMILES | FC(F)=C(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8F16/c9-2(10)1(4(12,13)7(19,20)21)3(11,6(16,17)18)5(14,15)8(22,23)24 |
| InChIKey | PFLCRJAVVULHAT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.06 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|