C9F16 — CID 91449769
1,1,2,3,4,4,5,6,7,7-decafluoro-3,5-bis(trifluoromethyl)hepta-1,6-diene (PubChem CID 91449769) has the molecular formula C9F16 and a molecular weight of 412.07 g/mol. Its IUPAC name is 1,1,2,3,4,4,5,6,7,7-decafluoro-3,5-bis(trifluoromethyl)hepta-1,6-diene.
| Compound Name | 1,1,2,3,4,4,5,6,7,7-decafluoro-3,5-bis(trifluoromethyl)hepta-1,6-diene |
|---|---|
| PubChem CID | 91449769 |
| Molecular Formula | C9F16 |
| Molecular Weight | 412.07 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | 1,1,2,3,4,4,5,6,7,7-decafluoro-3,5-bis(trifluoromethyl)hepta-1,6-diene |
| SMILES | FC(F)=C(F)C(F)(C(F)(F)F)C(F)(F)C(F)(C(F)=C(F)F)C(F)(F)F |
| InChI | InChI=1S/C9F16/c10-1(3(12)13)5(16,8(20,21)22)7(18,19)6(17,9(23,24)25)2(11)4(14)15 |
| InChIKey | LQYNLZQDTHKSRF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.07 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |