C9F18 — CID 175228320
4-(difluoromethylidene)-1,1,1,2,2,5,5,6,6,6-decafluoro-3,3-bis(trifluoromethyl)hexane (PubChem CID 175228320) has the molecular formula C9F18 and a molecular weight of 450.06 g/mol. Its IUPAC name is 4-(difluoromethylidene)-1,1,1,2,2,5,5,6,6,6-decafluoro-3,3-bis(trifluoromethyl)hexane.
| Compound Name | 4-(difluoromethylidene)-1,1,1,2,2,5,5,6,6,6-decafluoro-3,3-bis(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 175228320 |
| Molecular Formula | C9F18 |
| Molecular Weight | 450.06 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | 4-(difluoromethylidene)-1,1,1,2,2,5,5,6,6,6-decafluoro-3,3-bis(trifluoromethyl)hexane |
| SMILES | FC(F)=C(C(F)(F)C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9F18/c10-2(11)1(4(12,13)8(22,23)24)3(6(16,17)18,7(19,20)21)5(14,15)9(25,26)27 |
| InChIKey | VCRBWKCWKKEBMU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.06 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|