C18F30 — CID 6432266
1,2,3,4,5,6-hexakis(1,1,2,2,2-pentafluoroethyl)bicyclo[2.2.0]hexa-2,5-diene (PubChem CID 6432266) has the molecular formula C18F30 and a molecular weight of 786.14 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexakis(1,1,2,2,2-pentafluoroethyl)bicyclo[2.2.0]hexa-2,5-diene.
| Compound Name | 1,2,3,4,5,6-hexakis(1,1,2,2,2-pentafluoroethyl)bicyclo[2.2.0]hexa-2,5-diene |
|---|---|
| PubChem CID | 6432266 |
| Molecular Formula | C18F30 |
| Molecular Weight | 786.14 g/mol |
| Exact Mass | 785.95 |
| IUPAC Name | 1,2,3,4,5,6-hexakis(1,1,2,2,2-pentafluoroethyl)bicyclo[2.2.0]hexa-2,5-diene |
| SMILES | FC(F)(F)C(F)(F)C1=C(C(F)(F)C(F)(F)F)C2(C(F)(F)C(F)(F)F)C(C(F)(F)C(F)(F)F)=C(C(F)(F)C(F)(F)F)C12C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18F30/c19-7(20,13(31,32)33)1-2(8(21,22)14(34,35)36)6(12(29,30)18(46,47)48)4(10(25,26)16(40,41)42)3(9(23,24)15(37,38)39)5(1,6)11(27,28)17(43,44)45 |
| InChIKey | YLLDGGUEDJGVMO-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.14 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|