About ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate
ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate (PubChem CID 12600397) has the molecular formula C19H24N2O6S
and a molecular weight of 408.48 g/mol. Its IUPAC name is ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate |
| PubChem CID | 12600397 |
| Molecular Formula | C19H24N2O6S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(OC)c(OC)cc1S(=O)(=O)Nc1cc(C)ccn1 |
| InChI | InChI=1S/C19H24N2O6S/c1-5-27-19(22)7-6-14-11-15(25-3)16(26-4)12-17(14)28(23,24)21-18-10-13(2)8-9-20-18/h8-12H,5-7H2,1-4H3,(H,20,21) |
| InChIKey | HHDSKYPPIQCCNO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate?
The IUPAC name of ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate (CID 12600397) is ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate.
What is the SMILES notation for ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate?
The canonical SMILES for ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate is CCOC(=O)CCc1cc(OC)c(OC)cc1S(=O)(=O)Nc1cc(C)ccn1.
What is the InChIKey of ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate?
The InChIKey is HHDSKYPPIQCCNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O6S/c1-5-27-19(22)7-6-14-11-15(25-3)16(26-4)12-17(14)28(23,24)21-18-10-13(2)8-9-20-18/h8-12H,5-7H2,1-4H3,(H,20,21).
What are the key properties of ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate?
ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate has a molecular weight of 408.48 g/mol, XLogP of 2.70, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4,5-dimethoxy-2-[(4-methyl-2-pyridinyl)sulfamoyl]phenyl]propanoate is sourced from PubChem (CID 12600397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).