C13H16N2O5S — CID 102821599
ethyl 3-[[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]sulfamoyl]propanoate (PubChem CID 102821599) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is ethyl 3-[[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]sulfamoyl]propanoate.
| Compound Name | ethyl 3-[[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]sulfamoyl]propanoate |
|---|---|
| PubChem CID | 102821599 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | ethyl 3-[[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]sulfamoyl]propanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)Nc1cc(C#CCO)ccn1 |
| InChI | InChI=1S/C13H16N2O5S/c1-2-20-13(17)6-9-21(18,19)15-12-10-11(4-3-8-16)5-7-14-12/h5,7,10,16H,2,6,8-9H2,1H3,(H,14,15) |
| InChIKey | NEIPARMXGGPRHB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|