C15H14N2O3S — CID 102821632
N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-1-phenylmethanesulfonamide (PubChem CID 102821632) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-1-phenylmethanesulfonamide.
| Compound Name | N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 102821632 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)Nc1cc(C#CCO)ccn1 |
| InChI | InChI=1S/C15H14N2O3S/c18-10-4-7-13-8-9-16-15(11-13)17-21(19,20)12-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,18H,10,12H2,(H,16,17) |
| InChIKey | FSSBTWPMEOGURO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|