C10H13N3O3S — CID 102821691
4-[2-(methylsulfamoylamino)-4-pyridinyl]but-3-yn-1-ol (PubChem CID 102821691) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 4-[2-(methylsulfamoylamino)-4-pyridinyl]but-3-yn-1-ol.
| Compound Name | 4-[2-(methylsulfamoylamino)-4-pyridinyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 102821691 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 4-[2-(methylsulfamoylamino)-4-pyridinyl]but-3-yn-1-ol |
| SMILES | CNS(=O)(=O)Nc1cc(C#CCCO)ccn1 |
| InChI | InChI=1S/C10H13N3O3S/c1-11-17(15,16)13-10-8-9(5-6-12-10)4-2-3-7-14/h5-6,8,11,14H,3,7H2,1H3,(H,12,13) |
| InChIKey | BYAHWVKNGBOXQT-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|