C11H11N3O3S — CID 102821588
1-cyano-N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]ethanesulfonamide (PubChem CID 102821588) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 1-cyano-N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]ethanesulfonamide.
| Compound Name | 1-cyano-N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]ethanesulfonamide |
|---|---|
| PubChem CID | 102821588 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 1-cyano-N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]ethanesulfonamide |
| SMILES | CC(C#N)S(=O)(=O)Nc1cc(C#CCO)ccn1 |
| InChI | InChI=1S/C11H11N3O3S/c1-9(8-12)18(16,17)14-11-7-10(3-2-6-15)4-5-13-11/h4-5,7,9,15H,6H2,1H3,(H,13,14) |
| InChIKey | XOYFLJFWHXLWKO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|