C22H26I2N2O4 — CID 126004437
tert-butyl N-[(2S)-3-(4-hydroxy-3,5-diiodophenyl)-1-oxo-1-[[(1S)-1-phenylethyl]amino]propan-2-yl]carbamate (PubChem CID 126004437) has the molecular formula C22H26I2N2O4 and a molecular weight of 636.27 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-(4-hydroxy-3,5-diiodophenyl)-1-oxo-1-[[(1S)-1-phenylethyl]amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-(4-hydroxy-3,5-diiodophenyl)-1-oxo-1-[[(1S)-1-phenylethyl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 126004437 |
| Molecular Formula | C22H26I2N2O4 |
| Molecular Weight | 636.27 g/mol |
| Exact Mass | 636.00 |
| IUPAC Name | tert-butyl N-[(2S)-3-(4-hydroxy-3,5-diiodophenyl)-1-oxo-1-[[(1S)-1-phenylethyl]amino]propan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)[C@H](Cc1cc(I)c(O)c(I)c1)NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H26I2N2O4/c1-13(15-8-6-5-7-9-15)25-20(28)18(26-21(29)30-22(2,3)4)12-14-10-16(23)19(27)17(24)11-14/h5-11,13,18,27H,12H2,1-4H3,(H,25,28)(H,26,29)/t13-,18-/m0/s1 |
| InChIKey | IXNKZWHTYKWCCP-UGSOOPFHSA-N |
| XLogP | 4.91 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.27 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|