C18H26I2N2O4 — CID 126342451
tert-butyl N-[(2S)-1-[[(2S)-butan-2-yl]amino]-3-(4-hydroxy-3,5-diiodophenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 126342451) has the molecular formula C18H26I2N2O4 and a molecular weight of 588.22 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-butan-2-yl]amino]-3-(4-hydroxy-3,5-diiodophenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-butan-2-yl]amino]-3-(4-hydroxy-3,5-diiodophenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126342451 |
| Molecular Formula | C18H26I2N2O4 |
| Molecular Weight | 588.22 g/mol |
| Exact Mass | 588.00 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-butan-2-yl]amino]-3-(4-hydroxy-3,5-diiodophenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC[C@H](C)NC(=O)[C@H](Cc1cc(I)c(O)c(I)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26I2N2O4/c1-6-10(2)21-16(24)14(22-17(25)26-18(3,4)5)9-11-7-12(19)15(23)13(20)8-11/h7-8,10,14,23H,6,9H2,1-5H3,(H,21,24)(H,22,25)/t10-,14-/m0/s1 |
| InChIKey | NKBQGPDNPLOWQE-HZMBPMFUSA-N |
| XLogP | 3.95 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|