C8H13F6NO2S2 — CID 12600535
N-(2-butylsulfanyl-1,1,1,3,3,3-hexafluoropropan-2-yl)methanesulfonamide (PubChem CID 12600535) has the molecular formula C8H13F6NO2S2 and a molecular weight of 333.32 g/mol. Its IUPAC name is N-(2-butylsulfanyl-1,1,1,3,3,3-hexafluoropropan-2-yl)methanesulfonamide.
| Compound Name | N-(2-butylsulfanyl-1,1,1,3,3,3-hexafluoropropan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 12600535 |
| Molecular Formula | C8H13F6NO2S2 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-(2-butylsulfanyl-1,1,1,3,3,3-hexafluoropropan-2-yl)methanesulfonamide |
| SMILES | CCCCSC(NS(C)(=O)=O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H13F6NO2S2/c1-3-4-5-18-6(7(9,10)11,8(12,13)14)15-19(2,16)17/h15H,3-5H2,1-2H3 |
| InChIKey | GGQGWQCJGPOXNZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|