C24H21NO2 — CID 126007137
(6R,6aR,11bR)-6-(3-methylphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-4-carboxylic acid (PubChem CID 126007137) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is (6R,6aR,11bR)-6-(3-methylphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-4-carboxylic acid.
| Compound Name | (6R,6aR,11bR)-6-(3-methylphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 126007137 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (6R,6aR,11bR)-6-(3-methylphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-4-carboxylic acid |
| SMILES | Cc1cccc([C@@H]2Nc3c(C(=O)O)cccc3[C@H]3c4ccccc4C[C@H]32)c1 |
| InChI | InChI=1S/C24H21NO2/c1-14-6-4-8-16(12-14)22-20-13-15-7-2-3-9-17(15)21(20)18-10-5-11-19(24(26)27)23(18)25-22/h2-12,20-22,25H,13H2,1H3,(H,26,27)/t20-,21-,22+/m1/s1 |
| InChIKey | TVYUXCRLXHBGBK-VSKRKVRLSA-N |
| XLogP | 5.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |