C25H22NO4- — CID 7237553
(6R,6aS,11bS)-6-(2,3-dimethoxyphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-4-carboxylate (PubChem CID 7237553) has the molecular formula C25H22NO4- and a molecular weight of 400.45 g/mol. Its IUPAC name is (6R,6aS,11bS)-6-(2,3-dimethoxyphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-4-carboxylate.
| Compound Name | (6R,6aS,11bS)-6-(2,3-dimethoxyphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 7237553 |
| Molecular Formula | C25H22NO4- |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (6R,6aS,11bS)-6-(2,3-dimethoxyphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-4-carboxylate |
| SMILES | COc1cccc([C@@H]2Nc3c(C(=O)[O-])cccc3[C@@H]3c4ccccc4C[C@@H]32)c1OC |
| InChI | InChI=1S/C25H23NO4/c1-29-20-12-6-10-17(24(20)30-2)23-19-13-14-7-3-4-8-15(14)21(19)16-9-5-11-18(25(27)28)22(16)26-23/h3-12,19,21,23,26H,13H2,1-2H3,(H,27,28)/p-1/t19-,21-,23-/m0/s1 |
| InChIKey | REQDACGXRQSKGJ-RRPUWOKSSA-M |
| XLogP | 3.54 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |