C21H20BrNO4 — CID 51709238
(3aS,4R,9bS)-8-bromo-4-(2,3-dimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylic acid (PubChem CID 51709238) has the molecular formula C21H20BrNO4 and a molecular weight of 430.30 g/mol. Its IUPAC name is (3aS,4R,9bS)-8-bromo-4-(2,3-dimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylic acid.
| Compound Name | (3aS,4R,9bS)-8-bromo-4-(2,3-dimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 51709238 |
| Molecular Formula | C21H20BrNO4 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | (3aS,4R,9bS)-8-bromo-4-(2,3-dimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylic acid |
| SMILES | COc1cccc([C@@H]2Nc3c(C(=O)O)cc(Br)cc3[C@H]3C=CC[C@@H]32)c1OC |
| InChI | InChI=1S/C21H20BrNO4/c1-26-17-8-4-7-14(20(17)27-2)18-13-6-3-5-12(13)15-9-11(22)10-16(21(24)25)19(15)23-18/h3-5,7-10,12-13,18,23H,6H2,1-2H3,(H,24,25)/t12-,13-,18+/m0/s1 |
| InChIKey | FVVYCRYJKIXAPC-ZJNRKIDTSA-N |
| XLogP | 4.99 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|