C20H19BrFNO2 — CID 6958632
(3aR,4R,9bR)-8-bromo-4-(2,3-dimethoxyphenyl)-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 6958632) has the molecular formula C20H19BrFNO2 and a molecular weight of 404.28 g/mol. Its IUPAC name is (3aR,4R,9bR)-8-bromo-4-(2,3-dimethoxyphenyl)-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4R,9bR)-8-bromo-4-(2,3-dimethoxyphenyl)-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 6958632 |
| Molecular Formula | C20H19BrFNO2 |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | (3aR,4R,9bR)-8-bromo-4-(2,3-dimethoxyphenyl)-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cccc([C@@H]2Nc3c(F)cc(Br)cc3[C@@H]3C=CC[C@H]32)c1OC |
| InChI | InChI=1S/C20H19BrFNO2/c1-24-17-8-4-7-14(20(17)25-2)18-13-6-3-5-12(13)15-9-11(21)10-16(22)19(15)23-18/h3-5,7-10,12-13,18,23H,6H2,1-2H3/t12-,13-,18-/m1/s1 |
| InChIKey | BOKUEZDPRWVPMX-SNUQEOBHSA-N |
| XLogP | 5.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|