C18H13BrCl2FN — CID 126171805
(3aR,4S,9bR)-8-bromo-4-(2,3-dichlorophenyl)-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126171805) has the molecular formula C18H13BrCl2FN and a molecular weight of 413.12 g/mol. Its IUPAC name is (3aR,4S,9bR)-8-bromo-4-(2,3-dichlorophenyl)-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S,9bR)-8-bromo-4-(2,3-dichlorophenyl)-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126171805 |
| Molecular Formula | C18H13BrCl2FN |
| Molecular Weight | 413.12 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | (3aR,4S,9bR)-8-bromo-4-(2,3-dichlorophenyl)-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Fc1cc(Br)cc2c1N[C@H](c1cccc(Cl)c1Cl)[C@@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C18H13BrCl2FN/c19-9-7-13-10-3-1-4-11(10)17(23-18(13)15(22)8-9)12-5-2-6-14(20)16(12)21/h1-3,5-8,10-11,17,23H,4H2/t10-,11-,17+/m1/s1 |
| InChIKey | ZCVZWMXVUVFYIZ-AGKHESDQSA-N |
| XLogP | 6.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.12 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|