C20H14BrF3NO2- — CID 4230324
8-bromo-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylate (PubChem CID 4230324) has the molecular formula C20H14BrF3NO2- and a molecular weight of 437.24 g/mol. Its IUPAC name is 8-bromo-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylate.
| Compound Name | 8-bromo-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 4230324 |
| Molecular Formula | C20H14BrF3NO2- |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 8-bromo-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylate |
| SMILES | O=C([O-])c1cc(Br)cc2c1NC(c1ccccc1C(F)(F)F)C1CC=CC21 |
| InChI | InChI=1S/C20H15BrF3NO2/c21-10-8-14-11-5-3-6-12(11)17(25-18(14)15(9-10)19(26)27)13-4-1-2-7-16(13)20(22,23)24/h1-5,7-9,11-12,17,25H,6H2,(H,26,27)/p-1 |
| InChIKey | FSJSKGPHUKTDIJ-UHFFFAOYSA-M |
| XLogP | 4.66 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|