C21H20F3N — CID 126158898
(3aS,4S,9bR)-6,9-dimethyl-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126158898) has the molecular formula C21H20F3N and a molecular weight of 343.39 g/mol. Its IUPAC name is (3aS,4S,9bR)-6,9-dimethyl-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4S,9bR)-6,9-dimethyl-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126158898 |
| Molecular Formula | C21H20F3N |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (3aS,4S,9bR)-6,9-dimethyl-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1ccc(C)c2c1N[C@H](c1ccccc1C(F)(F)F)[C@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C21H20F3N/c1-12-10-11-13(2)19-18(12)14-7-5-8-15(14)20(25-19)16-6-3-4-9-17(16)21(22,23)24/h3-7,9-11,14-15,20,25H,8H2,1-2H3/t14-,15+,20+/m1/s1 |
| InChIKey | KNMFIPDIGZBKAN-SIFCLUCFSA-N |
| XLogP | 6.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|