C19H14ClF3N2O2 — CID 126173828
(3aR,4R,9bR)-6-chloro-9-nitro-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126173828) has the molecular formula C19H14ClF3N2O2 and a molecular weight of 394.78 g/mol. Its IUPAC name is (3aR,4R,9bR)-6-chloro-9-nitro-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4R,9bR)-6-chloro-9-nitro-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126173828 |
| Molecular Formula | C19H14ClF3N2O2 |
| Molecular Weight | 394.78 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (3aR,4R,9bR)-6-chloro-9-nitro-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | O=[N+]([O-])c1ccc(Cl)c2c1[C@@H]1C=CC[C@H]1[C@H](c1ccccc1C(F)(F)F)N2 |
| InChI | InChI=1S/C19H14ClF3N2O2/c20-14-8-9-15(25(26)27)16-10-5-3-6-11(10)17(24-18(14)16)12-4-1-2-7-13(12)19(21,22)23/h1-5,7-11,17,24H,6H2/t10-,11-,17-/m1/s1 |
| InChIKey | IPVUQYZAZSLHDF-CZIZLABSSA-N |
| XLogP | 6.09 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.78 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|