C19H16F3N — CID 126179776
(3aS,4S,9bR)-4-phenyl-6-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126179776) has the molecular formula C19H16F3N and a molecular weight of 315.34 g/mol. Its IUPAC name is (3aS,4S,9bR)-4-phenyl-6-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4S,9bR)-4-phenyl-6-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126179776 |
| Molecular Formula | C19H16F3N |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (3aS,4S,9bR)-4-phenyl-6-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | FC(F)(F)c1cccc2c1N[C@H](c1ccccc1)[C@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C19H16F3N/c20-19(21,22)16-11-5-10-15-13-8-4-9-14(13)17(23-18(15)16)12-6-2-1-3-7-12/h1-8,10-11,13-14,17,23H,9H2/t13-,14+,17-/m1/s1 |
| InChIKey | IWTCSXBKSOUBQM-JKIFEVAISA-N |
| XLogP | 5.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|