C19H15BrF3N — CID 126157371
(3aR,4R,9bR)-8-bromo-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126157371) has the molecular formula C19H15BrF3N and a molecular weight of 394.23 g/mol. Its IUPAC name is (3aR,4R,9bR)-8-bromo-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4R,9bR)-8-bromo-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126157371 |
| Molecular Formula | C19H15BrF3N |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | (3aR,4R,9bR)-8-bromo-4-[2-(trifluoromethyl)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | FC(F)(F)c1ccccc1[C@@H]1Nc2ccc(Br)cc2[C@@H]2C=CC[C@H]21 |
| InChI | InChI=1S/C19H15BrF3N/c20-11-8-9-17-15(10-11)12-5-3-6-13(12)18(24-17)14-4-1-2-7-16(14)19(21,22)23/h1-5,7-10,12-13,18,24H,6H2/t12-,13-,18-/m1/s1 |
| InChIKey | GGQICIFNDZVVHW-SNUQEOBHSA-N |
| XLogP | 6.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|