C21H21N5O — CID 126008161
1-cyclohexyl-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea (PubChem CID 126008161) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea.
| Compound Name | 1-cyclohexyl-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea |
|---|---|
| PubChem CID | 126008161 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-cyclohexyl-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea |
| SMILES | O=C(Nc1ccc2[nH]c3nc4ccccc4nc3c2c1)NC1CCCCC1 |
| InChI | InChI=1S/C21H21N5O/c27-21(22-13-6-2-1-3-7-13)23-14-10-11-16-15(12-14)19-20(25-16)26-18-9-5-4-8-17(18)24-19/h4-5,8-13H,1-3,6-7H2,(H,25,26)(H2,22,23,27) |
| InChIKey | WMYOQUAXPQTCAL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |