C10H13N3O2S — CID 126008179
N-ethyl-N'-[(Z)-(5-methylthiophen-2-yl)methylideneamino]oxamide (PubChem CID 126008179) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is N-ethyl-N'-[(Z)-(5-methylthiophen-2-yl)methylideneamino]oxamide.
| Compound Name | N-ethyl-N'-[(Z)-(5-methylthiophen-2-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 126008179 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | N-ethyl-N'-[(Z)-(5-methylthiophen-2-yl)methylideneamino]oxamide |
| SMILES | CCNC(=O)C(=O)N/N=C\c1ccc(C)s1 |
| InChI | InChI=1S/C10H13N3O2S/c1-3-11-9(14)10(15)13-12-6-8-5-4-7(2)16-8/h4-6H,3H2,1-2H3,(H,11,14)(H,13,15)/b12-6- |
| InChIKey | JDWHFYGUVMWAEU-SDQBBNPISA-N |
| XLogP | 0.64 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|