C7H9N3S2 — CID 5396200
[(Z)-(5-methylthiophen-2-yl)methylideneamino]thiourea (PubChem CID 5396200) has the molecular formula C7H9N3S2 and a molecular weight of 199.30 g/mol. Its IUPAC name is [(Z)-(5-methylthiophen-2-yl)methylideneamino]thiourea.
| Compound Name | [(Z)-(5-methylthiophen-2-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 5396200 |
| Molecular Formula | C7H9N3S2 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | [(Z)-(5-methylthiophen-2-yl)methylideneamino]thiourea |
| SMILES | Cc1ccc(/C=N\NC(N)=S)s1 |
| InChI | InChI=1S/C7H9N3S2/c1-5-2-3-6(12-5)4-9-10-7(8)11/h2-4H,1H3,(H3,8,10,11)/b9-4- |
| InChIKey | DQHCYNJJYRJYLA-WTKPLQERSA-N |
| XLogP | 1.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|