C13H13N3O3S2 — CID 45109579
N-[(E)-(5-methylthiophen-2-yl)methylideneamino]-4-sulfamoylbenzamide (PubChem CID 45109579) has the molecular formula C13H13N3O3S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(E)-(5-methylthiophen-2-yl)methylideneamino]-4-sulfamoylbenzamide.
| Compound Name | N-[(E)-(5-methylthiophen-2-yl)methylideneamino]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 45109579 |
| Molecular Formula | C13H13N3O3S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | N-[(E)-(5-methylthiophen-2-yl)methylideneamino]-4-sulfamoylbenzamide |
| SMILES | Cc1ccc(/C=N/NC(=O)c2ccc(S(N)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C13H13N3O3S2/c1-9-2-5-11(20-9)8-15-16-13(17)10-3-6-12(7-4-10)21(14,18)19/h2-8H,1H3,(H,16,17)(H2,14,18,19)/b15-8+ |
| InChIKey | UDTBPMDEHDWFAB-OVCLIPMQSA-N |
| XLogP | 1.47 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|