C14H10F3N3O3S — CID 6736191
4-sulfamoyl-N-[(2,4,5-trifluorophenyl)methylideneamino]benzamide (PubChem CID 6736191) has the molecular formula C14H10F3N3O3S and a molecular weight of 357.31 g/mol. Its IUPAC name is 4-sulfamoyl-N-[(2,4,5-trifluorophenyl)methylideneamino]benzamide.
| Compound Name | 4-sulfamoyl-N-[(2,4,5-trifluorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6736191 |
| Molecular Formula | C14H10F3N3O3S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4-sulfamoyl-N-[(2,4,5-trifluorophenyl)methylideneamino]benzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NN=Cc2cc(F)c(F)cc2F)cc1 |
| InChI | InChI=1S/C14H10F3N3O3S/c15-11-6-13(17)12(16)5-9(11)7-19-20-14(21)8-1-3-10(4-2-8)24(18,22)23/h1-7H,(H,20,21)(H2,18,22,23) |
| InChIKey | SEPSRCGEOCFFEL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|