C18H11F3N2O — CID 6736199
N-[(2,4,5-trifluorophenyl)methylideneamino]naphthalene-2-carboxamide (PubChem CID 6736199) has the molecular formula C18H11F3N2O and a molecular weight of 328.29 g/mol. Its IUPAC name is N-[(2,4,5-trifluorophenyl)methylideneamino]naphthalene-2-carboxamide.
| Compound Name | N-[(2,4,5-trifluorophenyl)methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 6736199 |
| Molecular Formula | C18H11F3N2O |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | N-[(2,4,5-trifluorophenyl)methylideneamino]naphthalene-2-carboxamide |
| SMILES | O=C(NN=Cc1cc(F)c(F)cc1F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H11F3N2O/c19-15-9-17(21)16(20)8-14(15)10-22-23-18(24)13-6-5-11-3-1-2-4-12(11)7-13/h1-10H,(H,23,24) |
| InChIKey | JBEOUADGQOSKCM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|