C28H22N4O6S — CID 135489914
N-[(Z)-(2-hydroxyphenyl)methylideneamino]-4-[4-[[(Z)-(2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]sulfonylbenzamide (PubChem CID 135489914) has the molecular formula C28H22N4O6S and a molecular weight of 542.57 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxyphenyl)methylideneamino]-4-[4-[[(Z)-(2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]sulfonylbenzamide.
| Compound Name | N-[(Z)-(2-hydroxyphenyl)methylideneamino]-4-[4-[[(Z)-(2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 135489914 |
| Molecular Formula | C28H22N4O6S |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | N-[(Z)-(2-hydroxyphenyl)methylideneamino]-4-[4-[[(Z)-(2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]sulfonylbenzamide |
| SMILES | O=C(N/N=C\c1ccccc1O)c1ccc(S(=O)(=O)c2ccc(C(=O)N/N=C\c3ccccc3O)cc2)cc1 |
| InChI | InChI=1S/C28H22N4O6S/c33-25-7-3-1-5-21(25)17-29-31-27(35)19-9-13-23(14-10-19)39(37,38)24-15-11-20(12-16-24)28(36)32-30-18-22-6-2-4-8-26(22)34/h1-18,33-34H,(H,31,35)(H,32,36)/b29-17-,30-18- |
| InChIKey | XOZNINFGLCIMPA-LZUTUTKMSA-N |
| XLogP | 3.46 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|